C19H21ClF2N4O6 — CID 59043938
(3S)-3-[[(2S)-1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-4,4-difluoropyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59043938) has the molecular formula C19H21ClF2N4O6 and a molecular weight of 474.85 g/mol. Its IUPAC name is (3S)-3-[[(2S)-1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-4,4-difluoropyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-4,4-difluoropyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59043938 |
| Molecular Formula | C19H21ClF2N4O6 |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (3S)-3-[[(2S)-1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-4,4-difluoropyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(=O)N1CC(F)(F)C[C@H]1C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C19H21ClF2N4O6/c1-9(24-16(30)10-2-3-13(23)12(20)4-10)18(32)26-8-19(21,22)6-14(26)17(31)25-11(7-27)5-15(28)29/h2-4,7,9,11,14H,5-6,8,23H2,1H3,(H,24,30)(H,25,31)(H,28,29)/t9-,11-,14-/m0/s1 |
| InChIKey | ZLRRBHUUDDFEMK-CHIMOYNISA-N |
| XLogP | 0.44 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|