C20H35ClO3 — CID 59044333
(1R,2R,3R,4R)-4-chloro-2-[(3R)-3-cyclohexyl-3-hydroxypropyl]-3-[(Z)-4-ethoxybut-2-enyl]cyclopentan-1-ol (PubChem CID 59044333) has the molecular formula C20H35ClO3 and a molecular weight of 358.95 g/mol. Its IUPAC name is (1R,2R,3R,4R)-4-chloro-2-[(3R)-3-cyclohexyl-3-hydroxypropyl]-3-[(Z)-4-ethoxybut-2-enyl]cyclopentan-1-ol.
| Compound Name | (1R,2R,3R,4R)-4-chloro-2-[(3R)-3-cyclohexyl-3-hydroxypropyl]-3-[(Z)-4-ethoxybut-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 59044333 |
| Molecular Formula | C20H35ClO3 |
| Molecular Weight | 358.95 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (1R,2R,3R,4R)-4-chloro-2-[(3R)-3-cyclohexyl-3-hydroxypropyl]-3-[(Z)-4-ethoxybut-2-enyl]cyclopentan-1-ol |
| SMILES | CCOC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)C2CCCCC2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C20H35ClO3/c1-2-24-13-7-6-10-16-17(20(23)14-18(16)21)11-12-19(22)15-8-4-3-5-9-15/h6-7,15-20,22-23H,2-5,8-14H2,1H3/b7-6-/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | NDYNSEVDYBNQEE-YRWGNFKQSA-N |
| XLogP | 4.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|