About 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine
3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 590449) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine.
Molecular Properties
| Compound Name | 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine |
| PubChem CID | 590449 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCc1nnc2cnccn12 |
| InChI | InChI=1S/C7H8N4/c1-2-6-9-10-7-5-8-3-4-11(6)7/h3-5H,2H2,1H3 |
| InChIKey | FWGLTJTVQUURRX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine?
The IUPAC name of 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine (CID 590449) is 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine.
What is the SMILES notation for 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine?
The canonical SMILES for 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine is CCc1nnc2cnccn12.
What is the InChIKey of 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine?
The InChIKey is FWGLTJTVQUURRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-2-6-9-10-7-5-8-3-4-11(6)7/h3-5H,2H2,1H3.
What are the key properties of 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine?
3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine has a molecular weight of 148.17 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-[1,2,4]triazolo[4,3-a]pyrazine is sourced from PubChem (CID 590449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).