C13H23N2P — CID 59045136
(1S,2S)-7-cyclopentyl-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undecane (PubChem CID 59045136) has the molecular formula C13H23N2P and a molecular weight of 238.31 g/mol. Its IUPAC name is (1S,2S)-7-cyclopentyl-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undecane.
| Compound Name | (1S,2S)-7-cyclopentyl-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 59045136 |
| Molecular Formula | C13H23N2P |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (1S,2S)-7-cyclopentyl-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undecane |
| SMILES | C1CCC(P2N3CCC[C@H]3[C@@H]3CCCN32)C1 |
| InChI | InChI=1S/C13H23N2P/c1-2-6-11(5-1)16-14-9-3-7-12(14)13-8-4-10-15(13)16/h11-13H,1-10H2/t12-,13-/m0/s1 |
| InChIKey | IVAOQVDDQUFNEL-STQMWFEESA-N |
| XLogP | 3.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|