C39H32ClN2O8S2+ — CID 59045383
2-[[5-chloro-2-[2-[[5-phenyl-3-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methyl]benzenesulfonic acid (PubChem CID 59045383) has the molecular formula C39H32ClN2O8S2+ and a molecular weight of 756.28 g/mol. Its IUPAC name is 2-[[5-chloro-2-[2-[[5-phenyl-3-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[5-chloro-2-[2-[[5-phenyl-3-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59045383 |
| Molecular Formula | C39H32ClN2O8S2+ |
| Molecular Weight | 756.28 g/mol |
| Exact Mass | 755.13 |
| IUPAC Name | 2-[[5-chloro-2-[2-[[5-phenyl-3-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methyl]benzenesulfonic acid |
| SMILES | CCC(=Cc1oc2ccc(-c3ccccc3)cc2[n+]1Cc1ccccc1SOOO)C=C1Oc2ccc(Cl)cc2N1Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C39H31ClN2O8S2/c1-2-26(21-39-42(33-23-31(40)17-19-35(33)48-39)25-30-13-7-9-15-37(30)52(44,45)46)20-38-41(24-29-12-6-8-14-36(29)51-50-49-43)32-22-28(16-18-34(32)47-38)27-10-4-3-5-11-27/h3-23H,2,24-25H2,1H3,(H-,43,44,45,46)/p+1 |
| InChIKey | AKNZRNADAGFHBB-UHFFFAOYSA-O |
| XLogP | 9.50 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.28 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|