C18H16FN3O2Y-2 — CID 59045423
3-(2-fluoro-4-methylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;3H-pyridin-3-ide;yttrium (PubChem CID 59045423) has the molecular formula C18H16FN3O2Y-2 and a molecular weight of 414.25 g/mol. Its IUPAC name is 3-(2-fluoro-4-methylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;3H-pyridin-3-ide;yttrium.
| Compound Name | 3-(2-fluoro-4-methylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 59045423 |
| Molecular Formula | C18H16FN3O2Y-2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 3-(2-fluoro-4-methylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;3H-pyridin-3-ide;yttrium |
| SMILES | Cc1[c-]cc(-n2c(=O)cc(C)n(C)c2=O)c(F)c1.[Y].[c-]1cccnc1 |
| InChI | InChI=1S/C13H12FN2O2.C5H4N.Y/c1-8-4-5-11(10(14)6-8)16-12(17)7-9(2)15(3)13(16)18;1-2-4-6-5-3-1;/h5-7H,1-3H3;1-2,4-5H;/q2*-1; |
| InChIKey | PCCYAADHJDPJLM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|