About 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane
1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane (PubChem CID 59045456) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane.
Molecular Properties
| Compound Name | 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane |
| PubChem CID | 59045456 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane |
| SMILES | COC1(CCC[C@H](C)C(C)C)CCCC1 |
| InChI | InChI=1S/C14H28O/c1-12(2)13(3)8-7-11-14(15-4)9-5-6-10-14/h12-13H,5-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | STLCIDUFBAOLNQ-ZDUSSCGKSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane?
The IUPAC name of 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane (CID 59045456) is 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane.
What is the SMILES notation for 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane?
The canonical SMILES for 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane is COC1(CCC[C@H](C)C(C)C)CCCC1.
What is the InChIKey of 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane?
The InChIKey is STLCIDUFBAOLNQ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H28O/c1-12(2)13(3)8-7-11-14(15-4)9-5-6-10-14/h12-13H,5-11H2,1-4H3/t13-/m0/s1.
What are the key properties of 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane?
1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane has a molecular weight of 212.38 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4,5-dimethylhexyl]-1-methoxycyclopentane is sourced from PubChem (CID 59045456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).