C13H13ClS3 — CID 59045719
4-(chloromethyl)-10-ethyl-5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 59045719) has the molecular formula C13H13ClS3 and a molecular weight of 300.90 g/mol. Its IUPAC name is 4-(chloromethyl)-10-ethyl-5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4-(chloromethyl)-10-ethyl-5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 59045719 |
| Molecular Formula | C13H13ClS3 |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 4-(chloromethyl)-10-ethyl-5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCc1sc2c(sc3c(C)c(CCl)sc32)c1C |
| InChI | InChI=1S/C13H13ClS3/c1-4-8-6(2)10-12(15-8)13-11(17-10)7(3)9(5-14)16-13/h4-5H2,1-3H3 |
| InChIKey | QWQBKQQISIBZGL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|