C21H25N5O2 — CID 59046234
(2S)-1-[2-phenyl-6-(propoxymethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 59046234) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-1-[2-phenyl-6-(propoxymethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-phenyl-6-(propoxymethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59046234 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (2S)-1-[2-phenyl-6-(propoxymethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCOCc1cc2c(N3CCC[C@H]3C(N)=O)nc(-c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C21H25N5O2/c1-2-11-28-13-15-12-16-20(23-15)24-19(14-7-4-3-5-8-14)25-21(16)26-10-6-9-17(26)18(22)27/h3-5,7-8,12,17H,2,6,9-11,13H2,1H3,(H2,22,27)(H,23,24,25)/t17-/m0/s1 |
| InChIKey | DKHGYOBFCNPZIT-KRWDZBQOSA-N |
| XLogP | 3.01 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|