C27H28ClN5O6 — CID 59046566
[(8S)-8-(chloromethyl)-1,2-dimethyl-6-(5-nitro-1-benzofuran-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate (PubChem CID 59046566) has the molecular formula C27H28ClN5O6 and a molecular weight of 554.00 g/mol. Its IUPAC name is [(8S)-8-(chloromethyl)-1,2-dimethyl-6-(5-nitro-1-benzofuran-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate.
| Compound Name | [(8S)-8-(chloromethyl)-1,2-dimethyl-6-(5-nitro-1-benzofuran-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 59046566 |
| Molecular Formula | C27H28ClN5O6 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | [(8S)-8-(chloromethyl)-1,2-dimethyl-6-(5-nitro-1-benzofuran-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate |
| SMILES | CNCCN(C)C(=O)Oc1cc2c(c3c(C)c(C)[nH]c13)[C@H](CCl)CN2C(=O)c1cc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C27H28ClN5O6/c1-14-15(2)30-25-21(39-27(35)31(4)8-7-29-3)11-19-24(23(14)25)17(12-28)13-32(19)26(34)22-10-16-9-18(33(36)37)5-6-20(16)38-22/h5-6,9-11,17,29-30H,7-8,12-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | BKYIKEBVXHHCPN-QGZVFWFLSA-N |
| XLogP | 5.07 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|