C50H48F2O4 — CID 59046670
[(1R,2R)-2-[4-(2-fluoro-4-pentylphenyl)benzoyl]oxy-1,2-diphenylethyl] 4-(2-fluoro-4-pentylphenyl)benzoate (PubChem CID 59046670) has the molecular formula C50H48F2O4 and a molecular weight of 750.93 g/mol. Its IUPAC name is [(1R,2R)-2-[4-(2-fluoro-4-pentylphenyl)benzoyl]oxy-1,2-diphenylethyl] 4-(2-fluoro-4-pentylphenyl)benzoate.
| Compound Name | [(1R,2R)-2-[4-(2-fluoro-4-pentylphenyl)benzoyl]oxy-1,2-diphenylethyl] 4-(2-fluoro-4-pentylphenyl)benzoate |
|---|---|
| PubChem CID | 59046670 |
| Molecular Formula | C50H48F2O4 |
| Molecular Weight | 750.93 g/mol |
| Exact Mass | 750.35 |
| IUPAC Name | [(1R,2R)-2-[4-(2-fluoro-4-pentylphenyl)benzoyl]oxy-1,2-diphenylethyl] 4-(2-fluoro-4-pentylphenyl)benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)O[C@H](c3ccccc3)[C@H](OC(=O)c3ccc(-c4ccc(CCCCC)cc4F)cc3)c3ccccc3)cc2)c(F)c1 |
| InChI | InChI=1S/C50H48F2O4/c1-3-5-9-15-35-21-31-43(45(51)33-35)37-23-27-41(28-24-37)49(53)55-47(39-17-11-7-12-18-39)48(40-19-13-8-14-20-40)56-50(54)42-29-25-38(26-30-42)44-32-22-36(34-46(44)52)16-10-6-4-2/h7-8,11-14,17-34,47-48H,3-6,9-10,15-16H2,1-2H3/t47-,48-/m1/s1 |
| InChIKey | AZPHNSIBRMAPQM-URZIEALYSA-N |
| XLogP | 13.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.93 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|