About N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide
N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 59046694) has the molecular formula C7H15F3N2O4S2
and a molecular weight of 312.34 g/mol. Its IUPAC name is N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide |
| PubChem CID | 59046694 |
| Molecular Formula | C7H15F3N2O4S2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O4S2/c1-3-5-12(6-4-2)18(15,16)11-17(13,14)7(8,9)10/h11H,3-6H2,1-2H3 |
| InChIKey | CHXGJRCJGWSLTH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide?
The IUPAC name of N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide (CID 59046694) is N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide.
What is the SMILES notation for N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide?
The canonical SMILES for N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide is CCCN(CCC)S(=O)(=O)NS(=O)(=O)C(F)(F)F.
What is the InChIKey of N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide?
The InChIKey is CHXGJRCJGWSLTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F3N2O4S2/c1-3-5-12(6-4-2)18(15,16)11-17(13,14)7(8,9)10/h11H,3-6H2,1-2H3.
What are the key properties of N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide?
N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide has a molecular weight of 312.34 g/mol, XLogP of 0.79, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dipropylsulfamoyl)-1,1,1-trifluoromethanesulfonamide is sourced from PubChem (CID 59046694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).