C24H22F3N3O2 — CID 59047055
ethyl 4-[13-cyano-6-(trifluoromethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate (PubChem CID 59047055) has the molecular formula C24H22F3N3O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is ethyl 4-[13-cyano-6-(trifluoromethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[13-cyano-6-(trifluoromethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59047055 |
| Molecular Formula | C24H22F3N3O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | ethyl 4-[13-cyano-6-(trifluoromethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(C#N)cc3CCc3cc(C(F)(F)F)cnc32)CC1 |
| InChI | InChI=1S/C24H22F3N3O2/c1-2-32-23(31)30-9-7-16(8-10-30)21-20-6-3-15(13-28)11-17(20)4-5-18-12-19(24(25,26)27)14-29-22(18)21/h3,6,11-12,14H,2,4-5,7-10H2,1H3 |
| InChIKey | DWUXQCSLWQXFDO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |