About 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine
2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 590473) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
Molecular Properties
| Compound Name | 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| PubChem CID | 590473 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2ccc(N)cn2n1 |
| InChI | InChI=1S/C7H8N4/c1-5-9-7-3-2-6(8)4-11(7)10-5/h2-4H,8H2,1H3 |
| InChIKey | DFYBVPNAIURTAZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The IUPAC name of 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (CID 590473) is 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
What is the SMILES notation for 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The canonical SMILES for 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine is Cc1nc2ccc(N)cn2n1.
What is the InChIKey of 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The InChIKey is DFYBVPNAIURTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-9-7-3-2-6(8)4-11(7)10-5/h2-4H,8H2,1H3.
What are the key properties of 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine has a molecular weight of 148.17 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine is sourced from PubChem (CID 590473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).