About tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate
tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate (PubChem CID 59047304) has the molecular formula C14H24N2O5S
and a molecular weight of 332.42 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate.
Molecular Properties
| Compound Name | tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate |
| PubChem CID | 59047304 |
| Molecular Formula | C14H24N2O5S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate |
| SMILES | Cc1noc(C)c1S(=O)(=O)N[C@H](C)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O5S/c1-9(7-8-12(17)20-14(4,5)6)16-22(18,19)13-10(2)15-21-11(13)3/h9,16H,7-8H2,1-6H3/t9-/m1/s1 |
| InChIKey | GMPXMFPFQZJBAW-SECBINFHSA-N |
| XLogP | 2.08 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate?
The IUPAC name of tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate (CID 59047304) is tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate.
What is the SMILES notation for tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate?
The canonical SMILES for tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate is Cc1noc(C)c1S(=O)(=O)N[C@H](C)CCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate?
The InChIKey is GMPXMFPFQZJBAW-SECBINFHSA-N. The full InChI is InChI=1S/C14H24N2O5S/c1-9(7-8-12(17)20-14(4,5)6)16-22(18,19)13-10(2)15-21-11(13)3/h9,16H,7-8H2,1-6H3/t9-/m1/s1.
What are the key properties of tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate?
tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate has a molecular weight of 332.42 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4R)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]pentanoate is sourced from PubChem (CID 59047304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).