About 1-azaspiro[4.5]dec-1-ene
1-azaspiro[4.5]dec-1-ene (PubChem CID 59047363) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-azaspiro[4.5]dec-1-ene.
Molecular Properties
| Compound Name | 1-azaspiro[4.5]dec-1-ene |
| PubChem CID | 59047363 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1-azaspiro[4.5]dec-1-ene |
| SMILES | C1=NC2(CC1)CCCCC2 |
| InChI | InChI=1S/C9H15N/c1-2-5-9(6-3-1)7-4-8-10-9/h8H,1-7H2 |
| InChIKey | NQNOPAGUVIDKCU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azaspiro[4.5]dec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[4.5]dec-1-ene?
The IUPAC name of 1-azaspiro[4.5]dec-1-ene (CID 59047363) is 1-azaspiro[4.5]dec-1-ene.
What is the SMILES notation for 1-azaspiro[4.5]dec-1-ene?
The canonical SMILES for 1-azaspiro[4.5]dec-1-ene is C1=NC2(CC1)CCCCC2.
What is the InChIKey of 1-azaspiro[4.5]dec-1-ene?
The InChIKey is NQNOPAGUVIDKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-2-5-9(6-3-1)7-4-8-10-9/h8H,1-7H2.
What are the key properties of 1-azaspiro[4.5]dec-1-ene?
1-azaspiro[4.5]dec-1-ene has a molecular weight of 137.23 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[4.5]dec-1-ene is sourced from PubChem (CID 59047363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).