C12H20O — CID 59047496
(2Z,5Z)-3,5-dimethyl-4-prop-2-enoxyhepta-2,5-diene (PubChem CID 59047496) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (2Z,5Z)-3,5-dimethyl-4-prop-2-enoxyhepta-2,5-diene.
| Compound Name | (2Z,5Z)-3,5-dimethyl-4-prop-2-enoxyhepta-2,5-diene |
|---|---|
| PubChem CID | 59047496 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2Z,5Z)-3,5-dimethyl-4-prop-2-enoxyhepta-2,5-diene |
| SMILES | C=CCOC(/C(C)=C\C)/C(C)=C\C |
| InChI | InChI=1S/C12H20O/c1-6-9-13-12(10(4)7-2)11(5)8-3/h6-8,12H,1,9H2,2-5H3/b10-7-,11-8- |
| InChIKey | WLEPMYSPTRTDLY-DEFDFUCDSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|