About 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide
2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide (PubChem CID 590477) has the molecular formula C8H16N2O6
and a molecular weight of 236.22 g/mol. Its IUPAC name is 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide.
Molecular Properties
| Compound Name | 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide |
| PubChem CID | 590477 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide |
| SMILES | O=C(NCCO)C(O)C(O)C(=O)NCCO |
| InChI | InChI=1S/C8H16N2O6/c11-3-1-9-7(15)5(13)6(14)8(16)10-2-4-12/h5-6,11-14H,1-4H2,(H,9,15)(H,10,16) |
| InChIKey | RQQWYAQGRARVOV-UHFFFAOYSA-N |
| XLogP | -4.07 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide?
The IUPAC name of 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide (CID 590477) is 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide.
What is the SMILES notation for 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide?
The canonical SMILES for 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide is O=C(NCCO)C(O)C(O)C(=O)NCCO.
What is the InChIKey of 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide?
The InChIKey is RQQWYAQGRARVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O6/c11-3-1-9-7(15)5(13)6(14)8(16)10-2-4-12/h5-6,11-14H,1-4H2,(H,9,15)(H,10,16).
What are the key properties of 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide?
2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide has a molecular weight of 236.22 g/mol, XLogP of -4.07, 7 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-N,N'-bis(2-hydroxyethyl)butanediamide is sourced from PubChem (CID 590477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).