About 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine
1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine (PubChem CID 59047711) has the molecular formula C32H32N2
and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine.
Molecular Properties
| Compound Name | 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine |
| PubChem CID | 59047711 |
| Molecular Formula | C32H32N2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine |
| SMILES | CC(C)(C)c1ccccc1/N=C1C(=N\c2ccccc2C(C)(C)C)\c2cccc3cccc\1c23 |
| InChI | InChI=1S/C32H32N2/c1-31(2,3)24-17-7-9-19-26(24)33-29-22-15-11-13-21-14-12-16-23(28(21)22)30(29)34-27-20-10-8-18-25(27)32(4,5)6/h7-20H,1-6H3/b33-29-,34-30+ |
| InChIKey | CSNWMWQXHNOEGM-HKQZHLORSA-N |
| XLogP | 8.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine?
The IUPAC name of 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine (CID 59047711) is 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine.
What is the SMILES notation for 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine?
The canonical SMILES for 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine is CC(C)(C)c1ccccc1/N=C1C(=N\c2ccccc2C(C)(C)C)\c2cccc3cccc\1c23.
What is the InChIKey of 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine?
The InChIKey is CSNWMWQXHNOEGM-HKQZHLORSA-N. The full InChI is InChI=1S/C32H32N2/c1-31(2,3)24-17-7-9-19-26(24)33-29-22-15-11-13-21-14-12-16-23(28(21)22)30(29)34-27-20-10-8-18-25(27)32(4,5)6/h7-20H,1-6H3/b33-29-,34-30+.
What are the key properties of 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine?
1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine has a molecular weight of 444.62 g/mol, XLogP of 8.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-bis(2-tert-butylphenyl)acenaphthylene-1,2-diimine is sourced from PubChem (CID 59047711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).