C4H11N3O2S — CID 59047923
N,N'-dideuterio-N-(deuteriosulfamoyl)-2-methylpropanimidamide (PubChem CID 59047923) has the molecular formula C4H11N3O2S and a molecular weight of 168.24 g/mol. Its IUPAC name is N,N'-dideuterio-N-(deuteriosulfamoyl)-2-methylpropanimidamide.
| Compound Name | N,N'-dideuterio-N-(deuteriosulfamoyl)-2-methylpropanimidamide |
|---|---|
| PubChem CID | 59047923 |
| Molecular Formula | C4H11N3O2S |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | N,N'-dideuterio-N-(deuteriosulfamoyl)-2-methylpropanimidamide |
| SMILES | [2H]/N=C(\C(C)C)N([2H])S(=O)(=O)N[2H] |
| InChI | InChI=1S/C4H11N3O2S/c1-3(2)4(5)7-10(6,8)9/h3H,1-2H3,(H2,5,7)(H2,6,8,9)/i/hD3 |
| InChIKey | MOMRBGFTEQNYPR-ZRLBSURWSA-N |
| XLogP | -0.59 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|