C19H35NSi — CID 59048623
trimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silane (PubChem CID 59048623) has the molecular formula C19H35NSi and a molecular weight of 305.58 g/mol. Its IUPAC name is trimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silane.
| Compound Name | trimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silane |
|---|---|
| PubChem CID | 59048623 |
| Molecular Formula | C19H35NSi |
| Molecular Weight | 305.58 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | trimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silane |
| SMILES | CC1CCC2C(C1)C1CC3CCCCC3C1N2[Si](C)(C)C |
| InChI | InChI=1S/C19H35NSi/c1-13-9-10-18-16(11-13)17-12-14-7-5-6-8-15(14)19(17)20(18)21(2,3)4/h13-19H,5-12H2,1-4H3 |
| InChIKey | JUDPSVQVFYXCOW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|