About (2S)-2-ethyl-1,3-dioxolan-4-ol
(2S)-2-ethyl-1,3-dioxolan-4-ol (PubChem CID 59048685) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is (2S)-2-ethyl-1,3-dioxolan-4-ol.
Molecular Properties
| Compound Name | (2S)-2-ethyl-1,3-dioxolan-4-ol |
| PubChem CID | 59048685 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (2S)-2-ethyl-1,3-dioxolan-4-ol |
| SMILES | CC[C@H]1OCC(O)O1 |
| InChI | InChI=1S/C5H10O3/c1-2-5-7-3-4(6)8-5/h4-6H,2-3H2,1H3/t4?,5-/m0/s1 |
| InChIKey | HKASQYOJVGMXRV-AKGZTFGVSA-N |
| XLogP | 0.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-ethyl-1,3-dioxolan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethyl-1,3-dioxolan-4-ol?
The IUPAC name of (2S)-2-ethyl-1,3-dioxolan-4-ol (CID 59048685) is (2S)-2-ethyl-1,3-dioxolan-4-ol.
What is the SMILES notation for (2S)-2-ethyl-1,3-dioxolan-4-ol?
The canonical SMILES for (2S)-2-ethyl-1,3-dioxolan-4-ol is CC[C@H]1OCC(O)O1.
What is the InChIKey of (2S)-2-ethyl-1,3-dioxolan-4-ol?
The InChIKey is HKASQYOJVGMXRV-AKGZTFGVSA-N. The full InChI is InChI=1S/C5H10O3/c1-2-5-7-3-4(6)8-5/h4-6H,2-3H2,1H3/t4?,5-/m0/s1.
What are the key properties of (2S)-2-ethyl-1,3-dioxolan-4-ol?
(2S)-2-ethyl-1,3-dioxolan-4-ol has a molecular weight of 118.13 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethyl-1,3-dioxolan-4-ol is sourced from PubChem (CID 59048685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).