About (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane
(8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane (PubChem CID 59048713) has the molecular formula C8H15NS2
and a molecular weight of 189.35 g/mol. Its IUPAC name is (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane |
| PubChem CID | 59048713 |
| Molecular Formula | C8H15NS2 |
| Molecular Weight | 189.35 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane |
| SMILES | C[C@@H]1CC2(CN1C)SCCS2 |
| InChI | InChI=1S/C8H15NS2/c1-7-5-8(6-9(7)2)10-3-4-11-8/h7H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | KYUUZXXPYIKNEY-SSDOTTSWSA-N |
| XLogP | 1.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane?
The IUPAC name of (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane (CID 59048713) is (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane.
What is the SMILES notation for (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane?
The canonical SMILES for (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane is C[C@@H]1CC2(CN1C)SCCS2.
What is the InChIKey of (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane?
The InChIKey is KYUUZXXPYIKNEY-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15NS2/c1-7-5-8(6-9(7)2)10-3-4-11-8/h7H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane?
(8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane has a molecular weight of 189.35 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-7,8-dimethyl-1,4-dithia-7-azaspiro[4.4]nonane is sourced from PubChem (CID 59048713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).