C19H20ClN2O2+ — CID 59048789
N-(5-chloro-2-hydroxyphenyl)-2-(2,3,3-trimethylindol-1-ium-1-yl)acetamide (PubChem CID 59048789) has the molecular formula C19H20ClN2O2+ and a molecular weight of 343.83 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-(2,3,3-trimethylindol-1-ium-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-(2,3,3-trimethylindol-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 59048789 |
| Molecular Formula | C19H20ClN2O2+ |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-(2,3,3-trimethylindol-1-ium-1-yl)acetamide |
| SMILES | CC1=[N+](CC(=O)Nc2cc(Cl)ccc2O)c2ccccc2C1(C)C |
| InChI | InChI=1S/C19H19ClN2O2/c1-12-19(2,3)14-6-4-5-7-16(14)22(12)11-18(24)21-15-10-13(20)8-9-17(15)23/h4-10H,11H2,1-3H3,(H-,21,23,24)/p+1 |
| InChIKey | ASBASQLIIRJAOT-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|