C30H29F7O — CID 59048966
2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene (PubChem CID 59048966) has the molecular formula C30H29F7O and a molecular weight of 538.55 g/mol. Its IUPAC name is 2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene.
| Compound Name | 2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 59048966 |
| Molecular Formula | C30H29F7O |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3cc(F)c(CCC(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C30H29F7O/c1-2-3-18-4-6-19(7-5-18)20-8-10-21(11-9-20)22-14-25(31)24(26(32)15-22)12-13-30(36,37)38-23-16-27(33)29(35)28(34)17-23/h8-11,14-19H,2-7,12-13H2,1H3 |
| InChIKey | FZZFBXIYKHKGQZ-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|