C44H32MnN8O4 — CID 59049276
manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1-methylimidazol-2-yl)porphyrin-22,24-diid-5-yl]benzoate (PubChem CID 59049276) has the molecular formula C44H32MnN8O4 and a molecular weight of 791.73 g/mol. Its IUPAC name is manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1-methylimidazol-2-yl)porphyrin-22,24-diid-5-yl]benzoate.
| Compound Name | manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1-methylimidazol-2-yl)porphyrin-22,24-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 59049276 |
| Molecular Formula | C44H32MnN8O4 |
| Molecular Weight | 791.73 g/mol |
| Exact Mass | 791.19 |
| IUPAC Name | manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1-methylimidazol-2-yl)porphyrin-22,24-diid-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4nccn4C)c4ccc([n-]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5nccn5C)c5ccc2[n-]5)C=C4)C=C3)cc1.[Mn+2] |
| InChI | InChI=1S/C44H33N8O4.Mn/c1-51-23-21-45-41(51)39-33-17-13-29(47-33)37(25-5-9-27(10-6-25)43(53)55-3)31-15-19-35(49-31)40(42-46-22-24-52(42)2)36-20-16-32(50-36)38(30-14-18-34(39)48-30)26-7-11-28(12-8-26)44(54)56-4;/h5-24H,1-4H3,(H-,45,46,47,48,49,50,53,54);/q-1;+2/p-1/b37-29-,37-31-,38-30-,38-32-,39-33+,39-34+,40-35+,40-36+; |
| InChIKey | UUTANJCWOIYVGK-ZETOMPDBSA-M |
| XLogP | 7.62 |
| TPSA | 142.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |