About N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine
N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine (PubChem CID 59049548) has the molecular formula C29H32IN3O
and a molecular weight of 565.50 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine |
| PubChem CID | 59049548 |
| Molecular Formula | C29H32IN3O |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine |
| SMILES | Ic1ccc(-c2cc(N(CCCN3CCCCCC3)Cc3cccc4ccccc34)on2)cc1 |
| InChI | InChI=1S/C29H32IN3O/c30-26-15-13-24(14-16-26)28-21-29(34-31-28)33(20-8-19-32-17-5-1-2-6-18-32)22-25-11-7-10-23-9-3-4-12-27(23)25/h3-4,7,9-16,21H,1-2,5-6,8,17-20,22H2 |
| InChIKey | XHUYPZNMRSQMJA-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine?
The IUPAC name of N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine (CID 59049548) is N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine.
What is the SMILES notation for N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine?
The canonical SMILES for N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine is Ic1ccc(-c2cc(N(CCCN3CCCCCC3)Cc3cccc4ccccc34)on2)cc1.
What is the InChIKey of N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine?
The InChIKey is XHUYPZNMRSQMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32IN3O/c30-26-15-13-24(14-16-26)28-21-29(34-31-28)33(20-8-19-32-17-5-1-2-6-18-32)22-25-11-7-10-23-9-3-4-12-27(23)25/h3-4,7,9-16,21H,1-2,5-6,8,17-20,22H2.
What are the key properties of N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine?
N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine has a molecular weight of 565.50 g/mol, XLogP of 7.37, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(azepan-1-yl)propyl]-3-(4-iodophenyl)-N-(naphthalen-1-ylmethyl)-1,2-oxazol-5-amine is sourced from PubChem (CID 59049548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).