C21H30FNO2 — CID 59049917
methyl 3-[4-(4-fluorophenyl)piperidin-1-yl]-1-propan-2-ylcyclopentane-1-carboxylate (PubChem CID 59049917) has the molecular formula C21H30FNO2 and a molecular weight of 347.47 g/mol. Its IUPAC name is methyl 3-[4-(4-fluorophenyl)piperidin-1-yl]-1-propan-2-ylcyclopentane-1-carboxylate.
| Compound Name | methyl 3-[4-(4-fluorophenyl)piperidin-1-yl]-1-propan-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 59049917 |
| Molecular Formula | C21H30FNO2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | methyl 3-[4-(4-fluorophenyl)piperidin-1-yl]-1-propan-2-ylcyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(C(C)C)CCC(N2CCC(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C21H30FNO2/c1-15(2)21(20(24)25-3)11-8-19(14-21)23-12-9-17(10-13-23)16-4-6-18(22)7-5-16/h4-7,15,17,19H,8-14H2,1-3H3 |
| InChIKey | ZUEVUURCTUGIIJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |