C28H33BF7N2O2PS — CID 59050039
2-[1-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-[4-(4-fluorophenyl)piperidin-1-yl]cyclopentyl]ethoxy-phosphanylborinothioic acid (PubChem CID 59050039) has the molecular formula C28H33BF7N2O2PS and a molecular weight of 636.42 g/mol. Its IUPAC name is 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-[4-(4-fluorophenyl)piperidin-1-yl]cyclopentyl]ethoxy-phosphanylborinothioic acid.
| Compound Name | 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-[4-(4-fluorophenyl)piperidin-1-yl]cyclopentyl]ethoxy-phosphanylborinothioic acid |
|---|---|
| PubChem CID | 59050039 |
| Molecular Formula | C28H33BF7N2O2PS |
| Molecular Weight | 636.42 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-[4-(4-fluorophenyl)piperidin-1-yl]cyclopentyl]ethoxy-phosphanylborinothioic acid |
| SMILES | O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1(CCOB(P)S)CCC(N2CCC(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C28H33BF7N2O2PS/c30-23-3-1-19(2-4-23)20-6-10-38(11-7-20)24-5-8-26(16-24,9-12-40-29(41)42)25(39)37-17-18-13-21(27(31,32)33)15-22(14-18)28(34,35)36/h1-4,13-15,20,24,42H,5-12,16-17,41H2,(H,37,39) |
| InChIKey | RXHNOEBSHHBEDF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.42 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|