C16H20N2 — CID 59050135
5-phenyl-2-propan-2-yl-4,5,6,7-tetrahydroindazole (PubChem CID 59050135) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-phenyl-2-propan-2-yl-4,5,6,7-tetrahydroindazole.
| Compound Name | 5-phenyl-2-propan-2-yl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 59050135 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-phenyl-2-propan-2-yl-4,5,6,7-tetrahydroindazole |
| SMILES | CC(C)n1cc2c(n1)CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C16H20N2/c1-12(2)18-11-15-10-14(8-9-16(15)17-18)13-6-4-3-5-7-13/h3-7,11-12,14H,8-10H2,1-2H3 |
| InChIKey | DSTGBAKCYIWBEV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |