C9H8F6N2 — CID 59050205
4,4,5,5,6,6-hexafluoro-2-propan-2-ylcyclopenta[c]pyrazole (PubChem CID 59050205) has the molecular formula C9H8F6N2 and a molecular weight of 258.16 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexafluoro-2-propan-2-ylcyclopenta[c]pyrazole.
| Compound Name | 4,4,5,5,6,6-hexafluoro-2-propan-2-ylcyclopenta[c]pyrazole |
|---|---|
| PubChem CID | 59050205 |
| Molecular Formula | C9H8F6N2 |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4,4,5,5,6,6-hexafluoro-2-propan-2-ylcyclopenta[c]pyrazole |
| SMILES | CC(C)n1cc2c(n1)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C9H8F6N2/c1-4(2)17-3-5-6(16-17)8(12,13)9(14,15)7(5,10)11/h3-4H,1-2H3 |
| InChIKey | JXVZLUXLUFDUDM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|