C10H17NO2S — CID 59050241
(4S)-4-acetyl-2-tert-butyl-1,3-thiazolidine-3-carbaldehyde (PubChem CID 59050241) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is (4S)-4-acetyl-2-tert-butyl-1,3-thiazolidine-3-carbaldehyde.
| Compound Name | (4S)-4-acetyl-2-tert-butyl-1,3-thiazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 59050241 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (4S)-4-acetyl-2-tert-butyl-1,3-thiazolidine-3-carbaldehyde |
| SMILES | CC(=O)[C@H]1CSC(C(C)(C)C)N1C=O |
| InChI | InChI=1S/C10H17NO2S/c1-7(13)8-5-14-9(10(2,3)4)11(8)6-12/h6,8-9H,5H2,1-4H3/t8-,9?/m1/s1 |
| InChIKey | YGBJMNPMYVTDDH-VEDVMXKPSA-N |
| XLogP | 1.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|