About 1,7-dimethylisoquinoline
1,7-dimethylisoquinoline (PubChem CID 59050335) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 1,7-dimethylisoquinoline.
Molecular Properties
| Compound Name | 1,7-dimethylisoquinoline |
| PubChem CID | 59050335 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1,7-dimethylisoquinoline |
| SMILES | Cc1ccc2ccnc(C)c2c1 |
| InChI | InChI=1S/C11H11N/c1-8-3-4-10-5-6-12-9(2)11(10)7-8/h3-7H,1-2H3 |
| InChIKey | ONPBUAIEJAFNRR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,7-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethylisoquinoline?
The IUPAC name of 1,7-dimethylisoquinoline (CID 59050335) is 1,7-dimethylisoquinoline.
What is the SMILES notation for 1,7-dimethylisoquinoline?
The canonical SMILES for 1,7-dimethylisoquinoline is Cc1ccc2ccnc(C)c2c1.
What is the InChIKey of 1,7-dimethylisoquinoline?
The InChIKey is ONPBUAIEJAFNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-8-3-4-10-5-6-12-9(2)11(10)7-8/h3-7H,1-2H3.
What are the key properties of 1,7-dimethylisoquinoline?
1,7-dimethylisoquinoline has a molecular weight of 157.22 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethylisoquinoline is sourced from PubChem (CID 59050335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).