C15H22O2 — CID 59050645
(4R,5S)-5-hydroxy-4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-9-en-2-one (PubChem CID 59050645) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4R,5S)-5-hydroxy-4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-9-en-2-one.
| Compound Name | (4R,5S)-5-hydroxy-4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-9-en-2-one |
|---|---|
| PubChem CID | 59050645 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (4R,5S)-5-hydroxy-4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-9-en-2-one |
| SMILES | CC1=CCC2C[C@]3(O)[C@H](C)CC(=O)C13C2(C)C |
| InChI | InChI=1S/C15H22O2/c1-9-5-6-11-8-14(17)10(2)7-12(16)15(9,14)13(11,3)4/h5,10-11,17H,6-8H2,1-4H3/t10-,11?,14+,15?/m1/s1 |
| InChIKey | YYUPTSPIYQCSDX-XJZOAQGMSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|