About 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea
1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea (PubChem CID 59050759) has the molecular formula C12H12F6N2OS
and a molecular weight of 346.30 g/mol. Its IUPAC name is 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea.
Molecular Properties
| Compound Name | 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea |
| PubChem CID | 59050759 |
| Molecular Formula | C12H12F6N2OS |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea |
| SMILES | OCCNC(=S)NCc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F6N2OS/c13-11(14,15)8-1-2-9(12(16,17)18)7(5-8)6-20-10(22)19-3-4-21/h1-2,5,21H,3-4,6H2,(H2,19,20,22) |
| InChIKey | QMFPMWLIILENJO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea?
The IUPAC name of 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea (CID 59050759) is 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea.
What is the SMILES notation for 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea?
The canonical SMILES for 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea is OCCNC(=S)NCc1cc(C(F)(F)F)ccc1C(F)(F)F.
What is the InChIKey of 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea?
The InChIKey is QMFPMWLIILENJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6N2OS/c13-11(14,15)8-1-2-9(12(16,17)18)7(5-8)6-20-10(22)19-3-4-21/h1-2,5,21H,3-4,6H2,(H2,19,20,22).
What are the key properties of 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea?
1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea has a molecular weight of 346.30 g/mol, XLogP of 2.68, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-hydroxyethyl)thiourea is sourced from PubChem (CID 59050759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).