About (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene
(1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene (PubChem CID 59051323) has the molecular formula C26H22O
and a molecular weight of 350.46 g/mol. Its IUPAC name is (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene.
Molecular Properties
| Compound Name | (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene |
| PubChem CID | 59051323 |
| Molecular Formula | C26H22O |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene |
| SMILES | C1=C(c2ccccc2)[C@H]2C=C(c3ccc(Oc4ccccc4)cc3)[C@@H]1CC2 |
| InChI | InChI=1S/C26H22O/c1-3-7-19(8-4-1)25-17-22-12-11-21(25)18-26(22)20-13-15-24(16-14-20)27-23-9-5-2-6-10-23/h1-10,13-18,21-22H,11-12H2/t21-,22-/m1/s1 |
| InChIKey | KYTAKCWRADPZAD-FGZHOGPDSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene?
The IUPAC name of (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene (CID 59051323) is (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene.
What is the SMILES notation for (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene?
The canonical SMILES for (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene is C1=C(c2ccccc2)[C@H]2C=C(c3ccc(Oc4ccccc4)cc3)[C@@H]1CC2.
What is the InChIKey of (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene?
The InChIKey is KYTAKCWRADPZAD-FGZHOGPDSA-N. The full InChI is InChI=1S/C26H22O/c1-3-7-19(8-4-1)25-17-22-12-11-21(25)18-26(22)20-13-15-24(16-14-20)27-23-9-5-2-6-10-23/h1-10,13-18,21-22H,11-12H2/t21-,22-/m1/s1.
What are the key properties of (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene?
(1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene has a molecular weight of 350.46 g/mol, XLogP of 6.99, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-2-(4-phenoxyphenyl)-5-phenylbicyclo[2.2.2]octa-2,5-diene is sourced from PubChem (CID 59051323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).