C22H18N2O2 — CID 59051473
N,N-dimethyl-3-pyren-1-yl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 59051473) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N,N-dimethyl-3-pyren-1-yl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N,N-dimethyl-3-pyren-1-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 59051473 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N,N-dimethyl-3-pyren-1-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)C(=O)C1CC(c2ccc3ccc4cccc5ccc2c3c45)=NO1 |
| InChI | InChI=1S/C22H18N2O2/c1-24(2)22(25)19-12-18(23-26-19)16-10-8-15-7-6-13-4-3-5-14-9-11-17(16)21(15)20(13)14/h3-11,19H,12H2,1-2H3 |
| InChIKey | ZKADKSCDLPHUID-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|