C10H13FN4O4 — CID 59051696
4-amino-1-[(2R,3R,4E,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidin-2-one (PubChem CID 59051696) has the molecular formula C10H13FN4O4 and a molecular weight of 272.24 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4E,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4E,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 59051696 |
| Molecular Formula | C10H13FN4O4 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-amino-1-[(2R,3R,4E,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidin-2-one |
| SMILES | CO/N=C1/[C@@H](F)[C@H](n2ccc(N)nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C10H13FN4O4/c1-18-14-8-5(4-16)19-9(7(8)11)15-3-2-6(12)13-10(15)17/h2-3,5,7,9,16H,4H2,1H3,(H2,12,13,17)/b14-8+/t5-,7-,9-/m1/s1 |
| InChIKey | GZPNRZNFGNDMCW-HAPZMRDFSA-N |
| XLogP | -0.94 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|