C37H58O4Si2 — CID 59051908
(4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-7-[tert-butyl(diphenyl)silyl]oxyhept-2-en-2-yl]-4-propan-2-yloxan-2-one (PubChem CID 59051908) has the molecular formula C37H58O4Si2 and a molecular weight of 623.04 g/mol. Its IUPAC name is (4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-7-[tert-butyl(diphenyl)silyl]oxyhept-2-en-2-yl]-4-propan-2-yloxan-2-one.
| Compound Name | (4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-7-[tert-butyl(diphenyl)silyl]oxyhept-2-en-2-yl]-4-propan-2-yloxan-2-one |
|---|---|
| PubChem CID | 59051908 |
| Molecular Formula | C37H58O4Si2 |
| Molecular Weight | 623.04 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | (4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-7-[tert-butyl(diphenyl)silyl]oxyhept-2-en-2-yl]-4-propan-2-yloxan-2-one |
| SMILES | C/C(=C\CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1OC(=O)C[C@H](C(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H58O4Si2/c1-28(2)32-27-33(38)40-34(35(32)41-42(10,11)36(4,5)6)29(3)21-15-14-20-26-39-43(37(7,8)9,30-22-16-12-17-23-30)31-24-18-13-19-25-31/h12-13,16-19,21-25,28,32,34-35H,14-15,20,26-27H2,1-11H3/b29-21+/t32-,34+,35-/m1/s1 |
| InChIKey | VYWAABXEZWSGFF-KCVNJBKNSA-N |
| XLogP | 8.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.04 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|