C38H60O4Si2 — CID 59051910
methyl (1R,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-3-methyl-6-propan-2-ylcyclohex-3-ene-1-carboxylate (PubChem CID 59051910) has the molecular formula C38H60O4Si2 and a molecular weight of 637.07 g/mol. Its IUPAC name is methyl (1R,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-3-methyl-6-propan-2-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-3-methyl-6-propan-2-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 59051910 |
| Molecular Formula | C38H60O4Si2 |
| Molecular Weight | 637.07 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | methyl (1R,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-3-methyl-6-propan-2-ylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C=C(C)[C@H]1CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H60O4Si2/c1-28(2)34-33(42-43(11,12)37(4,5)6)27-29(3)32(35(34)36(39)40-10)25-19-20-26-41-44(38(7,8)9,30-21-15-13-16-22-30)31-23-17-14-18-24-31/h13-18,21-24,27-28,32-35H,19-20,25-26H2,1-12H3/t32-,33+,34-,35-/m1/s1 |
| InChIKey | JZUFTYPPYHIYPL-AOJHZZQJSA-N |
| XLogP | 8.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.07 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|