C25H20F6N2O4 — CID 59051992
2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1S,2R)-2-nitro-1-phenyl-3-[2-(trifluoromethyl)phenyl]propyl]acetamide (PubChem CID 59051992) has the molecular formula C25H20F6N2O4 and a molecular weight of 526.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1S,2R)-2-nitro-1-phenyl-3-[2-(trifluoromethyl)phenyl]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1S,2R)-2-nitro-1-phenyl-3-[2-(trifluoromethyl)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 59051992 |
| Molecular Formula | C25H20F6N2O4 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1S,2R)-2-nitro-1-phenyl-3-[2-(trifluoromethyl)phenyl]propyl]acetamide |
| SMILES | COc1ccc(N(C(=O)C(F)(F)F)[C@@H](c2ccccc2)[C@@H](Cc2ccccc2C(F)(F)F)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H20F6N2O4/c1-37-19-13-11-18(12-14-19)32(23(34)25(29,30)31)22(16-7-3-2-4-8-16)21(33(35)36)15-17-9-5-6-10-20(17)24(26,27)28/h2-14,21-22H,15H2,1H3/t21-,22+/m1/s1 |
| InChIKey | FSAHJTZWQQRGSB-YADHBBJMSA-N |
| XLogP | 6.24 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|