About (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one
(2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 59052169) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one |
| PubChem CID | 59052169 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | CCC(O)C[C@H](O)[C@@H]1CC(OC)=CC(=O)O1 |
| InChI | InChI=1S/C11H18O5/c1-3-7(12)4-9(13)10-5-8(15-2)6-11(14)16-10/h6-7,9-10,12-13H,3-5H2,1-2H3/t7?,9-,10-/m0/s1 |
| InChIKey | QPHDBTAGXJAYBS-IVNRZZHDSA-N |
| XLogP | 0.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one?
The IUPAC name of (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one (CID 59052169) is (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one?
The canonical SMILES for (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one is CCC(O)C[C@H](O)[C@@H]1CC(OC)=CC(=O)O1.
What is the InChIKey of (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one?
The InChIKey is QPHDBTAGXJAYBS-IVNRZZHDSA-N. The full InChI is InChI=1S/C11H18O5/c1-3-7(12)4-9(13)10-5-8(15-2)6-11(14)16-10/h6-7,9-10,12-13H,3-5H2,1-2H3/t7?,9-,10-/m0/s1.
What are the key properties of (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one?
(2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one has a molecular weight of 230.26 g/mol, XLogP of 0.35, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1S)-1,3-dihydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one is sourced from PubChem (CID 59052169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).