C30H54O7Si — CID 59052189
(2S)-2-[(2S,5S)-5-[(3R)-3-[(2R,5S)-5-[(2R,3S)-3-[(2S,5R)-5-methyloxolan-2-yl]-2-triethylsilyloxybutyl]oxolan-2-yl]-2-oxobutyl]oxolan-2-yl]propanoic acid (PubChem CID 59052189) has the molecular formula C30H54O7Si and a molecular weight of 554.84 g/mol. Its IUPAC name is (2S)-2-[(2S,5S)-5-[(3R)-3-[(2R,5S)-5-[(2R,3S)-3-[(2S,5R)-5-methyloxolan-2-yl]-2-triethylsilyloxybutyl]oxolan-2-yl]-2-oxobutyl]oxolan-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(2S,5S)-5-[(3R)-3-[(2R,5S)-5-[(2R,3S)-3-[(2S,5R)-5-methyloxolan-2-yl]-2-triethylsilyloxybutyl]oxolan-2-yl]-2-oxobutyl]oxolan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 59052189 |
| Molecular Formula | C30H54O7Si |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (2S)-2-[(2S,5S)-5-[(3R)-3-[(2R,5S)-5-[(2R,3S)-3-[(2S,5R)-5-methyloxolan-2-yl]-2-triethylsilyloxybutyl]oxolan-2-yl]-2-oxobutyl]oxolan-2-yl]propanoic acid |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@@H]1CC[C@H]([C@@H](C)C(=O)C[C@@H]2CC[C@@H]([C@H](C)C(=O)O)O2)O1)[C@@H](C)[C@@H]1CC[C@@H](C)O1 |
| InChI | InChI=1S/C30H54O7Si/c1-8-38(9-2,10-3)37-29(21(6)27-14-11-19(4)34-27)18-24-13-15-26(36-24)20(5)25(31)17-23-12-16-28(35-23)22(7)30(32)33/h19-24,26-29H,8-18H2,1-7H3,(H,32,33)/t19-,20+,21+,22+,23+,24+,26-,27+,28+,29-/m1/s1 |
| InChIKey | ANTJXROEXJGHCF-OOXYDOPNSA-N |
| XLogP | 6.38 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|