C17H13F3O3S — CID 59052237
(E)-1,1,1-trifluoro-3-(4-methylphenyl)sulfonyl-4-phenylbut-3-en-2-one (PubChem CID 59052237) has the molecular formula C17H13F3O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-3-(4-methylphenyl)sulfonyl-4-phenylbut-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-3-(4-methylphenyl)sulfonyl-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 59052237 |
| Molecular Formula | C17H13F3O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (E)-1,1,1-trifluoro-3-(4-methylphenyl)sulfonyl-4-phenylbut-3-en-2-one |
| SMILES | Cc1ccc(S(=O)(=O)/C(=C/c2ccccc2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3O3S/c1-12-7-9-14(10-8-12)24(22,23)15(16(21)17(18,19)20)11-13-5-3-2-4-6-13/h2-11H,1H3/b15-11+ |
| InChIKey | ZXFWYKSBMFNORY-RVDMUPIBSA-N |
| XLogP | 3.94 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|