C16H17ClO7 — CID 59052319
3-O-ethyl 1-O,1-O-dimethyl 2-(4-chlorophenyl)-3-oxopropane-1,1,3-tricarboxylate (PubChem CID 59052319) has the molecular formula C16H17ClO7 and a molecular weight of 356.76 g/mol. Its IUPAC name is 3-O-ethyl 1-O,1-O-dimethyl 2-(4-chlorophenyl)-3-oxopropane-1,1,3-tricarboxylate.
| Compound Name | 3-O-ethyl 1-O,1-O-dimethyl 2-(4-chlorophenyl)-3-oxopropane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 59052319 |
| Molecular Formula | C16H17ClO7 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 3-O-ethyl 1-O,1-O-dimethyl 2-(4-chlorophenyl)-3-oxopropane-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C(=O)C(c1ccc(Cl)cc1)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H17ClO7/c1-4-24-16(21)13(18)11(9-5-7-10(17)8-6-9)12(14(19)22-2)15(20)23-3/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | GRLXMZCUEUKWEL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|