C23H22F3N3O7 — CID 59052409
(5S,8S)-1-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 59052409) has the molecular formula C23H22F3N3O7 and a molecular weight of 509.44 g/mol. Its IUPAC name is (5S,8S)-1-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (5S,8S)-1-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 59052409 |
| Molecular Formula | C23H22F3N3O7 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (5S,8S)-1-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-phenyl-1,3,7-triazaspiro[4.4]nonane-8-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2C(=O)N(c3ccccc3)C(=O)[C@]23CN[C@H](C(=O)O)C3)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21N3O5.C2HF3O2/c1-29-16-9-7-14(8-10-16)12-23-20(28)24(15-5-3-2-4-6-15)19(27)21(23)11-17(18(25)26)22-13-21;3-2(4,5)1(6)7/h2-10,17,22H,11-13H2,1H3,(H,25,26);(H,6,7)/t17-,21-;/m0./s1 |
| InChIKey | DLJGKTGSPSRDJE-PVMVIUQGSA-N |
| XLogP | 2.48 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|