C17H31BO2 — CID 59052615
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 59052615) has the molecular formula C17H31BO2 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 59052615 |
| Molecular Formula | C17H31BO2 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCC/C(C)=C/CCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H31BO2/c1-14(2)10-8-11-15(3)12-9-13-18-19-16(4,5)17(6,7)20-18/h10,12H,8-9,11,13H2,1-7H3/b15-12+ |
| InChIKey | YVRZEPMZYYXVPY-NTCAYCPXSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|