C17H22N2O7 — CID 59052826
ethyl 2-[(2R,4S,6S,8R)-2,6-dihydroxy-8-(5-methyl-2,4-dioxopyrimidin-1-yl)-9-oxatricyclo[4.3.0.02,4]nonan-4-yl]acetate (PubChem CID 59052826) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is ethyl 2-[(2R,4S,6S,8R)-2,6-dihydroxy-8-(5-methyl-2,4-dioxopyrimidin-1-yl)-9-oxatricyclo[4.3.0.02,4]nonan-4-yl]acetate.
| Compound Name | ethyl 2-[(2R,4S,6S,8R)-2,6-dihydroxy-8-(5-methyl-2,4-dioxopyrimidin-1-yl)-9-oxatricyclo[4.3.0.02,4]nonan-4-yl]acetate |
|---|---|
| PubChem CID | 59052826 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 2-[(2R,4S,6S,8R)-2,6-dihydroxy-8-(5-methyl-2,4-dioxopyrimidin-1-yl)-9-oxatricyclo[4.3.0.02,4]nonan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@]12C[C@]3(O)C[C@H](n4cc(C)c(=O)[nH]c4=O)OC3[C@@]1(O)C2 |
| InChI | InChI=1S/C17H22N2O7/c1-3-25-11(20)5-15-7-16(23)4-10(26-13(16)17(15,24)8-15)19-6-9(2)12(21)18-14(19)22/h6,10,13,23-24H,3-5,7-8H2,1-2H3,(H,18,21,22)/t10-,13?,15-,16-,17+/m1/s1 |
| InChIKey | FDEZNBWDWXCJTP-PXNKFRNKSA-N |
| XLogP | -0.66 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |