C17H22O4 — CID 59052987
(3'aS,4'aR,8'aS,8'bS)-8'a-acetyl-6'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'-one (PubChem CID 59052987) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3'aS,4'aR,8'aS,8'bS)-8'a-acetyl-6'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'-one.
| Compound Name | (3'aS,4'aR,8'aS,8'bS)-8'a-acetyl-6'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'-one |
|---|---|
| PubChem CID | 59052987 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (3'aS,4'aR,8'aS,8'bS)-8'a-acetyl-6'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'-one |
| SMILES | CC(=O)[C@]12C(=O)C=C(C)C[C@H]1C[C@H]1[C@@H]2CCC12OCCO2 |
| InChI | InChI=1S/C17H22O4/c1-10-7-12-9-14-13(3-4-16(14)20-5-6-21-16)17(12,11(2)18)15(19)8-10/h8,12-14H,3-7,9H2,1-2H3/t12-,13-,14-,17-/m0/s1 |
| InChIKey | CWAQJNYAGZYMJK-WSMBLCCSSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|