C19H24O6 — CID 59052988
methyl 3-[(3'aS,4'aR,8'aS,8'bS)-6'-methyl-8'-oxospiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'a-yl]-3-oxopropanoate (PubChem CID 59052988) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 3-[(3'aS,4'aR,8'aS,8'bS)-6'-methyl-8'-oxospiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'a-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[(3'aS,4'aR,8'aS,8'bS)-6'-methyl-8'-oxospiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'a-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 59052988 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | methyl 3-[(3'aS,4'aR,8'aS,8'bS)-6'-methyl-8'-oxospiro[1,3-dioxolane-2,3'-2,3a,4,4a,5,8b-hexahydro-1H-cyclopenta[a]indene]-8'a-yl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)[C@]12C(=O)C=C(C)C[C@H]1C[C@H]1[C@@H]2CCC12OCCO2 |
| InChI | InChI=1S/C19H24O6/c1-11-7-12-9-14-13(3-4-18(14)24-5-6-25-18)19(12,15(20)8-11)16(21)10-17(22)23-2/h8,12-14H,3-7,9-10H2,1-2H3/t12-,13-,14-,19+/m0/s1 |
| InChIKey | ZMGNTUHEZRCCTE-WFTHSTBKSA-N |
| XLogP | 1.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|